ChemNet > CAS > 301334-95-2 3-{4-[4-(2-methoxyphenyl)piperidino]-3-nitrophenyl}acrylic acid
301334-95-2 3-{4-[4-(2-methoxyphenyl)piperidino]-3-nitrophenyl}acrylic acid
Nama produk |
3-{4-[4-(2-methoxyphenyl)piperidino]-3-nitrophenyl}acrylic acid |
Nama bahasa Inggris |
3-{4-[4-(2-methoxyphenyl)piperidino]-3-nitrophenyl}acrylic acid; 3-[4-[4-(2-Methoxyphenyl)piperidino]-3-nitrophenyl]acrylic acid; (2E)-3-{4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl}prop-2-enoic acid |
MF |
C21H22N2O5 |
Berat Molekul |
382.4098 |
InChI |
InChI=1/C21H22N2O5/c1-28-20-5-3-2-4-17(20)16-10-12-22(13-11-16)18-8-6-15(7-9-21(24)25)14-19(18)23(26)27/h2-9,14,16H,10-13H2,1H3,(H,24,25)/b9-7+ |
CAS NO |
301334-95-2 |
Struktur Molekul |
|
Kepadatan |
1.286g/cm3 |
Titik lebur |
204℃ |
Titik didih |
591.4°C at 760 mmHg |
Indeks bias |
1.633 |
Titik nyala |
311.5°C |
Tekanan uap |
7.85E-15mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|